C17H28Cl2O2Si — CID 19073649
3-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dichlorophenyl)methyl]butan-1-ol (PubChem CID 19073649) has the molecular formula C17H28Cl2O2Si and a molecular weight of 363.40 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dichlorophenyl)methyl]butan-1-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dichlorophenyl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 19073649 |
| Molecular Formula | C17H28Cl2O2Si |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dichlorophenyl)methyl]butan-1-ol |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C(CO)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H28Cl2O2Si/c1-12(21-22(5,6)17(2,3)4)14(11-20)9-13-7-8-15(18)16(19)10-13/h7-8,10,12,14,20H,9,11H2,1-6H3 |
| InChIKey | HKPGJEIJJJPRLH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|