C12H15BrCl2 — CID 63529593
4-(2-bromo-3-methylpentyl)-1,2-dichlorobenzene (PubChem CID 63529593) has the molecular formula C12H15BrCl2 and a molecular weight of 310.06 g/mol. Its IUPAC name is 4-(2-bromo-3-methylpentyl)-1,2-dichlorobenzene.
| Compound Name | 4-(2-bromo-3-methylpentyl)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 63529593 |
| Molecular Formula | C12H15BrCl2 |
| Molecular Weight | 310.06 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 4-(2-bromo-3-methylpentyl)-1,2-dichlorobenzene |
| SMILES | CCC(C)C(Br)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15BrCl2/c1-3-8(2)10(13)6-9-4-5-11(14)12(15)7-9/h4-5,7-8,10H,3,6H2,1-2H3 |
| InChIKey | XCSUUDKAECUGRY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.06 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|