C14H23ClFNOSi — CID 175532246
(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-fluorophenyl)ethanamine (PubChem CID 175532246) has the molecular formula C14H23ClFNOSi and a molecular weight of 303.88 g/mol. Its IUPAC name is (1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-fluorophenyl)ethanamine.
| Compound Name | (1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 175532246 |
| Molecular Formula | C14H23ClFNOSi |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(3-chloro-4-fluorophenyl)ethanamine |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](N)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H23ClFNOSi/c1-14(2,3)19(4,5)18-13(17)9-10-6-7-12(16)11(15)8-10/h6-8,13H,9,17H2,1-5H3/t13-/m0/s1 |
| InChIKey | KCQDDRRGVPDFBK-ZDUSSCGKSA-N |
| XLogP | 4.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|