C13H19ClFNO — CID 103042919
1-(3-chloro-4-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-amine (PubChem CID 103042919) has the molecular formula C13H19ClFNO and a molecular weight of 259.75 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-amine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-amine |
|---|---|
| PubChem CID | 103042919 |
| Molecular Formula | C13H19ClFNO |
| Molecular Weight | 259.75 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-amine |
| SMILES | CC(C)(C)OCC(N)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H19ClFNO/c1-13(2,3)17-8-10(16)6-9-4-5-12(15)11(14)7-9/h4-5,7,10H,6,8,16H2,1-3H3 |
| InChIKey | XAMNSQPRLOMLFQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |