C16H17Cl2NO2 — CID 65190367
3-amino-2-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)propan-1-ol (PubChem CID 65190367) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 3-amino-2-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 3-amino-2-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 65190367 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-amino-2-(3,4-dichlorophenyl)-1-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(C(O)C(CN)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl2NO2/c1-21-12-5-2-10(3-6-12)16(20)13(9-19)11-4-7-14(17)15(18)8-11/h2-8,13,16,20H,9,19H2,1H3 |
| InChIKey | JRFNHKAWUWRXEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |