C16H17Cl2NO — CID 65190727
3-amino-2-(3,4-dichlorophenyl)-1-(2-methylphenyl)propan-1-ol (PubChem CID 65190727) has the molecular formula C16H17Cl2NO and a molecular weight of 310.22 g/mol. Its IUPAC name is 3-amino-2-(3,4-dichlorophenyl)-1-(2-methylphenyl)propan-1-ol.
| Compound Name | 3-amino-2-(3,4-dichlorophenyl)-1-(2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 65190727 |
| Molecular Formula | C16H17Cl2NO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-amino-2-(3,4-dichlorophenyl)-1-(2-methylphenyl)propan-1-ol |
| SMILES | Cc1ccccc1C(O)C(CN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO/c1-10-4-2-3-5-12(10)16(20)13(9-19)11-6-7-14(17)15(18)8-11/h2-8,13,16,20H,9,19H2,1H3 |
| InChIKey | BIHGSEMIEZTMSQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |