C14H22Cl2O2Si — CID 66783955
4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dichlorophenol (PubChem CID 66783955) has the molecular formula C14H22Cl2O2Si and a molecular weight of 321.32 g/mol. Its IUPAC name is 4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dichlorophenol.
| Compound Name | 4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 66783955 |
| Molecular Formula | C14H22Cl2O2Si |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,6-dichlorophenol |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C14H22Cl2O2Si/c1-9(18-19(5,6)14(2,3)4)10-7-11(15)13(17)12(16)8-10/h7-9,17H,1-6H3 |
| InChIKey | GTTAVYYWTDUIKI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|