C18H33NOSi — CID 139706247
2-tert-butyl-5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]aniline (PubChem CID 139706247) has the molecular formula C18H33NOSi and a molecular weight of 307.55 g/mol. Its IUPAC name is 2-tert-butyl-5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]aniline.
| Compound Name | 2-tert-butyl-5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]aniline |
|---|---|
| PubChem CID | 139706247 |
| Molecular Formula | C18H33NOSi |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-tert-butyl-5-[1-[tert-butyl(dimethyl)silyl]oxyethyl]aniline |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1ccc(C(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C18H33NOSi/c1-13(20-21(8,9)18(5,6)7)14-10-11-15(16(19)12-14)17(2,3)4/h10-13H,19H2,1-9H3 |
| InChIKey | KAVYZTPOKFAWFF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|