About 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane
1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 152674428) has the molecular formula C18H32O5Si
and a molecular weight of 356.54 g/mol. Its IUPAC name is 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane |
| PubChem CID | 152674428 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | COCOc1ccc(C(C)O[Si](C)(C)C(C)(C)C)c(OCOC)c1 |
| InChI | InChI=1S/C18H32O5Si/c1-14(23-24(7,8)18(2,3)4)16-10-9-15(21-12-19-5)11-17(16)22-13-20-6/h9-11,14H,12-13H2,1-8H3 |
| InChIKey | ZMFQGDDBWOFMCK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane?
The IUPAC name of 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane (CID 152674428) is 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane.
What is the SMILES notation for 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane?
The canonical SMILES for 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane is COCOc1ccc(C(C)O[Si](C)(C)C(C)(C)C)c(OCOC)c1.
What is the InChIKey of 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane?
The InChIKey is ZMFQGDDBWOFMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O5Si/c1-14(23-24(7,8)18(2,3)4)16-10-9-15(21-12-19-5)11-17(16)22-13-20-6/h9-11,14H,12-13H2,1-8H3.
What are the key properties of 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane?
1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane has a molecular weight of 356.54 g/mol, XLogP of 4.73, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(methoxymethoxy)phenyl]ethoxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 152674428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).