C16H23Cl2NO2Si — CID 66975505
4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)-3-hydroxybutanenitrile (PubChem CID 66975505) has the molecular formula C16H23Cl2NO2Si and a molecular weight of 360.36 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)-3-hydroxybutanenitrile.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)-3-hydroxybutanenitrile |
|---|---|
| PubChem CID | 66975505 |
| Molecular Formula | C16H23Cl2NO2Si |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-(3,4-dichlorophenyl)-3-hydroxybutanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O)C(C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2NO2Si/c1-16(2,3)22(4,5)21-10-15(20)12(9-19)11-6-7-13(17)14(18)8-11/h6-8,12,15,20H,10H2,1-5H3 |
| InChIKey | CAWHHOFZTDYOCV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|