C13H22ClNO2Si — CID 164921040
2-[tert-butyl(dimethyl)silyl]oxy-1-(5-chloro-2-pyridinyl)ethanol (PubChem CID 164921040) has the molecular formula C13H22ClNO2Si and a molecular weight of 287.86 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-1-(5-chloro-2-pyridinyl)ethanol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-(5-chloro-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 164921040 |
| Molecular Formula | C13H22ClNO2Si |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-(5-chloro-2-pyridinyl)ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H22ClNO2Si/c1-13(2,3)18(4,5)17-9-12(16)11-7-6-10(14)8-15-11/h6-8,12,16H,9H2,1-5H3 |
| InChIKey | VRIKZFQWXHGWJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|