C13H22ClNOSSi — CID 22964739
tert-butyl-[2-[(5-chloro-2-pyridinyl)sulfanyl]ethoxy]-dimethylsilane (PubChem CID 22964739) has the molecular formula C13H22ClNOSSi and a molecular weight of 303.93 g/mol. Its IUPAC name is tert-butyl-[2-[(5-chloro-2-pyridinyl)sulfanyl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(5-chloro-2-pyridinyl)sulfanyl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 22964739 |
| Molecular Formula | C13H22ClNOSSi |
| Molecular Weight | 303.93 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | tert-butyl-[2-[(5-chloro-2-pyridinyl)sulfanyl]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCSc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H22ClNOSSi/c1-13(2,3)18(4,5)16-8-9-17-12-7-6-11(14)10-15-12/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | DGOYHDPGNJPNCR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|