C23H33Cl2NO2Si — CID 66976278
4-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxy-3-(3,4-dichlorophenyl)butan-2-ol (PubChem CID 66976278) has the molecular formula C23H33Cl2NO2Si and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxy-3-(3,4-dichlorophenyl)butan-2-ol.
| Compound Name | 4-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxy-3-(3,4-dichlorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 66976278 |
| Molecular Formula | C23H33Cl2NO2Si |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-(benzylamino)-1-[tert-butyl(dimethyl)silyl]oxy-3-(3,4-dichlorophenyl)butan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O)C(CNCc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H33Cl2NO2Si/c1-23(2,3)29(4,5)28-16-22(27)19(18-11-12-20(24)21(25)13-18)15-26-14-17-9-7-6-8-10-17/h6-13,19,22,26-27H,14-16H2,1-5H3 |
| InChIKey | RCLSMSYOLDSYAE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|