C18H32FNOSi — CID 71761913
(2R)-N-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropentan-1-amine (PubChem CID 71761913) has the molecular formula C18H32FNOSi and a molecular weight of 325.54 g/mol. Its IUPAC name is (2R)-N-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropentan-1-amine.
| Compound Name | (2R)-N-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropentan-1-amine |
|---|---|
| PubChem CID | 71761913 |
| Molecular Formula | C18H32FNOSi |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (2R)-N-benzyl-5-[tert-butyl(dimethyl)silyl]oxy-2-fluoropentan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@H](F)CNCc1ccccc1 |
| InChI | InChI=1S/C18H32FNOSi/c1-18(2,3)22(4,5)21-13-9-12-17(19)15-20-14-16-10-7-6-8-11-16/h6-8,10-11,17,20H,9,12-15H2,1-5H3/t17-/m1/s1 |
| InChIKey | RHGVPGLDAJHQIM-QGZVFWFLSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|