C15H24Br2OSi — CID 15262613
tert-butyl-(3,3-dibromo-1-phenylpropoxy)-dimethylsilane (PubChem CID 15262613) has the molecular formula C15H24Br2OSi and a molecular weight of 408.25 g/mol. Its IUPAC name is tert-butyl-(3,3-dibromo-1-phenylpropoxy)-dimethylsilane.
| Compound Name | tert-butyl-(3,3-dibromo-1-phenylpropoxy)-dimethylsilane |
|---|---|
| PubChem CID | 15262613 |
| Molecular Formula | C15H24Br2OSi |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | tert-butyl-(3,3-dibromo-1-phenylpropoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC(Br)Br)c1ccccc1 |
| InChI | InChI=1S/C15H24Br2OSi/c1-15(2,3)19(4,5)18-13(11-14(16)17)12-9-7-6-8-10-12/h6-10,13-14H,11H2,1-5H3 |
| InChIKey | ZVSKGIGFQXSMNO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|