C23H38Cl3NO4Si — CID 11375949
2,2,2-trichloroethyl N-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-1-phenylheptan-3-yl]-N-methylcarbamate (PubChem CID 11375949) has the molecular formula C23H38Cl3NO4Si and a molecular weight of 527.01 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-1-phenylheptan-3-yl]-N-methylcarbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-1-phenylheptan-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 11375949 |
| Molecular Formula | C23H38Cl3NO4Si |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(1S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-1-phenylheptan-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCC(Cl)(Cl)Cl)[C@@H](CCCCO)C[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H38Cl3NO4Si/c1-22(2,3)32(5,6)31-20(18-12-8-7-9-13-18)16-19(14-10-11-15-28)27(4)21(29)30-17-23(24,25)26/h7-9,12-13,19-20,28H,10-11,14-17H2,1-6H3/t19-,20-/m0/s1 |
| InChIKey | ZRIRTTWEZROSSR-PMACEKPBSA-N |
| XLogP | 7.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|