C14H23NO4Si — CID 11335479
(1R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-nitroethanol (PubChem CID 11335479) has the molecular formula C14H23NO4Si and a molecular weight of 297.43 g/mol. Its IUPAC name is (1R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-nitroethanol.
| Compound Name | (1R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-nitroethanol |
|---|---|
| PubChem CID | 11335479 |
| Molecular Formula | C14H23NO4Si |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1R)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-nitroethanol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc([C@@H](O)C[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H23NO4Si/c1-14(2,3)20(4,5)19-12-8-6-11(7-9-12)13(16)10-15(17)18/h6-9,13,16H,10H2,1-5H3/t13-/m0/s1 |
| InChIKey | APVXHHHJAORJNB-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|