C18H28O4Si — CID 46850140
[(Z)-4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-hydroxybut-1-enyl] acetate (PubChem CID 46850140) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is [(Z)-4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-hydroxybut-1-enyl] acetate.
| Compound Name | [(Z)-4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-hydroxybut-1-enyl] acetate |
|---|---|
| PubChem CID | 46850140 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(Z)-4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-4-hydroxybut-1-enyl] acetate |
| SMILES | CC(=O)O/C=C\CC(O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28O4Si/c1-14(19)21-13-7-8-17(20)15-9-11-16(12-10-15)22-23(5,6)18(2,3)4/h7,9-13,17,20H,8H2,1-6H3/b13-7- |
| InChIKey | VEGXWDZZZREVPA-QPEQYQDCSA-N |
| XLogP | 4.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|