C16H24O4Si — CID 132820359
(Z)-2-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]but-2-enoic acid (PubChem CID 132820359) has the molecular formula C16H24O4Si and a molecular weight of 308.45 g/mol. Its IUPAC name is (Z)-2-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]but-2-enoic acid.
| Compound Name | (Z)-2-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 132820359 |
| Molecular Formula | C16H24O4Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (Z)-2-[4-[tert-butyl(dimethyl)silyl]oxyphenoxy]but-2-enoic acid |
| SMILES | C/C=C(\Oc1ccc(O[Si](C)(C)C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C16H24O4Si/c1-7-14(15(17)18)19-12-8-10-13(11-9-12)20-21(5,6)16(2,3)4/h7-11H,1-6H3,(H,17,18)/b14-7- |
| InChIKey | FNGFSRDWXALMJS-AUWJEWJLSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|