About [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate
[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate (PubChem CID 102025531) has the molecular formula C25H30N2O3Si
and a molecular weight of 434.61 g/mol. Its IUPAC name is [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate.
Molecular Properties
| Compound Name | [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate |
| PubChem CID | 102025531 |
| Molecular Formula | C25H30N2O3Si |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccc(OC(=O)c3cc(N)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O3Si/c1-25(2,3)31(4,5)30-23-12-8-18(9-13-23)17-6-10-22(11-7-17)29-24(28)19-14-20(26)16-21(27)15-19/h6-16H,26-27H2,1-5H3 |
| InChIKey | LJGLJQILKNJIGB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate?
The IUPAC name of [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate (CID 102025531) is [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate.
What is the SMILES notation for [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate?
The canonical SMILES for [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate is CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccc(OC(=O)c3cc(N)cc(N)c3)cc2)cc1.
What is the InChIKey of [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate?
The InChIKey is LJGLJQILKNJIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O3Si/c1-25(2,3)31(4,5)30-23-12-8-18(9-13-23)17-6-10-22(11-7-17)29-24(28)19-14-20(26)16-21(27)15-19/h6-16H,26-27H2,1-5H3.
What are the key properties of [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate?
[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate has a molecular weight of 434.61 g/mol, XLogP of 6.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate is sourced from PubChem (CID 102025531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).