C25H30N2O3Si — CID 102025531
[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate (PubChem CID 102025531) has the molecular formula C25H30N2O3Si and a molecular weight of 434.61 g/mol. Its IUPAC name is [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate.
| Compound Name | [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 102025531 |
| Molecular Formula | C25H30N2O3Si |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl] 3,5-diaminobenzoate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccc(OC(=O)c3cc(N)cc(N)c3)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O3Si/c1-25(2,3)31(4,5)30-23-12-8-18(9-13-23)17-6-10-22(11-7-17)29-24(28)19-14-20(26)16-21(27)15-19/h6-16H,26-27H2,1-5H3 |
| InChIKey | LJGLJQILKNJIGB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|