C15H25NO3Si — CID 69186234
[4-[tert-butyl(dimethyl)silyl]oxyphenyl] N-ethylcarbamate (PubChem CID 69186234) has the molecular formula C15H25NO3Si and a molecular weight of 295.46 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxyphenyl] N-ethylcarbamate.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 69186234 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3Si/c1-7-16-14(17)18-12-8-10-13(11-9-12)19-20(5,6)15(2,3)4/h8-11H,7H2,1-6H3,(H,16,17) |
| InChIKey | BUDBPGMUDFTBPM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|