C18H29NO4Si — CID 67570149
[(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 67570149) has the molecular formula C18H29NO4Si and a molecular weight of 351.52 g/mol. Its IUPAC name is [(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67570149 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | [(2S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)[C@H](NC(=O)O)C(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO4Si/c1-12(2)15(19-17(21)22)16(20)13-8-10-14(11-9-13)23-24(6,7)18(3,4)5/h8-12,15,19H,1-7H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | MBQAWULISJFXIA-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|