C22H31NO3Si — CID 140521974
[(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl] N-benzylcarbamate (PubChem CID 140521974) has the molecular formula C22H31NO3Si and a molecular weight of 385.58 g/mol. Its IUPAC name is [(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl] N-benzylcarbamate.
| Compound Name | [(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 140521974 |
| Molecular Formula | C22H31NO3Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | [(1S)-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl] N-benzylcarbamate |
| SMILES | C[C@H](OC(=O)NCc1ccccc1)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31NO3Si/c1-17(25-21(24)23-16-18-10-8-7-9-11-18)19-12-14-20(15-13-19)26-27(5,6)22(2,3)4/h7-15,17H,16H2,1-6H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | WEFWPOPVCPWTEF-KRWDZBQOSA-N |
| XLogP | 6.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|