C14H14N2O3S — CID 175377376
[(2S)-1-oxo-1-(1,3-thiazol-2-yl)propan-2-yl] N-benzylcarbamate (PubChem CID 175377376) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(1,3-thiazol-2-yl)propan-2-yl] N-benzylcarbamate.
| Compound Name | [(2S)-1-oxo-1-(1,3-thiazol-2-yl)propan-2-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 175377376 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [(2S)-1-oxo-1-(1,3-thiazol-2-yl)propan-2-yl] N-benzylcarbamate |
| SMILES | C[C@H](OC(=O)NCc1ccccc1)C(=O)c1nccs1 |
| InChI | InChI=1S/C14H14N2O3S/c1-10(12(17)13-15-7-8-20-13)19-14(18)16-9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | NUHINEQVNQFNAH-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |