C13H19N3O3 — CID 162689535
[1-(2-aminoethylamino)-1-oxopropan-2-yl] N-benzylcarbamate (PubChem CID 162689535) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [1-(2-aminoethylamino)-1-oxopropan-2-yl] N-benzylcarbamate.
| Compound Name | [1-(2-aminoethylamino)-1-oxopropan-2-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 162689535 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [1-(2-aminoethylamino)-1-oxopropan-2-yl] N-benzylcarbamate |
| SMILES | CC(OC(=O)NCc1ccccc1)C(=O)NCCN |
| InChI | InChI=1S/C13H19N3O3/c1-10(12(17)15-8-7-14)19-13(18)16-9-11-5-3-2-4-6-11/h2-6,10H,7-9,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | RANMYEYJJIHERH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |