C13H15N3OS — CID 49470436
1-benzyl-3-[2-(1,3-thiazol-2-yl)ethyl]urea (PubChem CID 49470436) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 1-benzyl-3-[2-(1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-benzyl-3-[2-(1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 49470436 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-benzyl-3-[2-(1,3-thiazol-2-yl)ethyl]urea |
| SMILES | O=C(NCCc1nccs1)NCc1ccccc1 |
| InChI | InChI=1S/C13H15N3OS/c17-13(15-7-6-12-14-8-9-18-12)16-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H2,15,16,17) |
| InChIKey | AFCWTPOVINPYNY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |