C8H10F3N3OS — CID 49470389
1-[2-(1,3-thiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 49470389) has the molecular formula C8H10F3N3OS and a molecular weight of 253.25 g/mol. Its IUPAC name is 1-[2-(1,3-thiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(1,3-thiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 49470389 |
| Molecular Formula | C8H10F3N3OS |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-[2-(1,3-thiazol-2-yl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCc1nccs1)NCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3OS/c9-8(10,11)5-14-7(15)13-2-1-6-12-3-4-16-6/h3-4H,1-2,5H2,(H2,13,14,15) |
| InChIKey | JRLJWCCRVVIMLP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |