C11H12F4N2O — CID 115575958
1-[2-(4-fluorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115575958) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115575958 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCc1ccc(F)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C11H12F4N2O/c12-9-3-1-8(2-4-9)5-6-16-10(18)17-7-11(13,14)15/h1-4H,5-7H2,(H2,16,17,18) |
| InChIKey | NYTQOHVWWROVBH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |