C16H23FN2O — CID 108915195
1-[2-(4-fluorophenyl)ethyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea (PubChem CID 108915195) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108915195 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
| SMILES | C/C(=C\NC(=O)NCCc1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H23FN2O/c1-12(16(2,3)4)11-19-15(20)18-10-9-13-5-7-14(17)8-6-13/h5-8,11H,9-10H2,1-4H3,(H2,18,19,20)/b12-11+ |
| InChIKey | BXYWRYKTWQNGTK-VAWYXSNFSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |