C42H50O4 — CID 3571413
[4-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]phenyl] 3,5-ditert-butylbenzoate (PubChem CID 3571413) has the molecular formula C42H50O4 and a molecular weight of 618.86 g/mol. Its IUPAC name is [4-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]phenyl] 3,5-ditert-butylbenzoate.
| Compound Name | [4-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]phenyl] 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 3571413 |
| Molecular Formula | C42H50O4 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | [4-[4-(3,5-ditert-butylbenzoyl)oxyphenyl]phenyl] 3,5-ditert-butylbenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2ccc(-c3ccc(OC(=O)c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H50O4/c1-39(2,3)31-21-29(22-32(25-31)40(4,5)6)37(43)45-35-17-13-27(14-18-35)28-15-19-36(20-16-28)46-38(44)30-23-33(41(7,8)9)26-34(24-30)42(10,11)12/h13-26H,1-12H3 |
| InChIKey | WXHYPQONVFFYTF-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|