About [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane
[2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane (PubChem CID 169498298) has the molecular formula C14H21BrCl2OSi
and a molecular weight of 384.22 g/mol. Its IUPAC name is [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane |
| PubChem CID | 169498298 |
| Molecular Formula | C14H21BrCl2OSi |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CBr)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H21BrCl2OSi/c1-14(2,3)19(4,5)18-12(9-15)13-10(16)7-6-8-11(13)17/h6-8,12H,9H2,1-5H3 |
| InChIKey | LGMRVXLAGFQRPT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane?
The IUPAC name of [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane (CID 169498298) is [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane.
What is the SMILES notation for [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane?
The canonical SMILES for [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane is CC(C)(C)[Si](C)(C)OC(CBr)c1c(Cl)cccc1Cl.
What is the InChIKey of [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane?
The InChIKey is LGMRVXLAGFQRPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrCl2OSi/c1-14(2,3)19(4,5)18-12(9-15)13-10(16)7-6-8-11(13)17/h6-8,12H,9H2,1-5H3.
What are the key properties of [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane?
[2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane has a molecular weight of 384.22 g/mol, XLogP of 6.45, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane is sourced from PubChem (CID 169498298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).