C14H21BrCl2OSi — CID 169498298
[2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane (PubChem CID 169498298) has the molecular formula C14H21BrCl2OSi and a molecular weight of 384.22 g/mol. Its IUPAC name is [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 169498298 |
| Molecular Formula | C14H21BrCl2OSi |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [2-bromo-1-(2,6-dichlorophenyl)ethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CBr)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H21BrCl2OSi/c1-14(2,3)19(4,5)18-12(9-15)13-10(16)7-6-8-11(13)17/h6-8,12H,9H2,1-5H3 |
| InChIKey | LGMRVXLAGFQRPT-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|