C25H35Cl2NO3Si — CID 70143421
ethyl (2S)-2-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6-dichlorophenyl)ethyl]phenyl]propanoate (PubChem CID 70143421) has the molecular formula C25H35Cl2NO3Si and a molecular weight of 496.55 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6-dichlorophenyl)ethyl]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6-dichlorophenyl)ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 70143421 |
| Molecular Formula | C25H35Cl2NO3Si |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | ethyl (2S)-2-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6-dichlorophenyl)ethyl]phenyl]propanoate |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(CC(O[Si](C)(C)C(C)(C)C)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C25H35Cl2NO3Si/c1-7-30-24(29)21(28)15-17-11-13-18(14-12-17)16-22(31-32(5,6)25(2,3)4)23-19(26)9-8-10-20(23)27/h8-14,21-22H,7,15-16,28H2,1-6H3/t21-,22?/m0/s1 |
| InChIKey | QYKQSRDSAIVEFG-HMTLIYDFSA-N |
| XLogP | 6.73 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|