C22H35ClO2Si2 — CID 15437908
tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-8-chloronaphthalen-2-yl]oxy-dimethylsilane (PubChem CID 15437908) has the molecular formula C22H35ClO2Si2 and a molecular weight of 423.15 g/mol. Its IUPAC name is tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-8-chloronaphthalen-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-8-chloronaphthalen-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15437908 |
| Molecular Formula | C22H35ClO2Si2 |
| Molecular Weight | 423.15 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-8-chloronaphthalen-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2cccc(Cl)c2c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35ClO2Si2/c1-21(2,3)26(7,8)24-18-15-14-16-12-11-13-17(23)19(16)20(18)25-27(9,10)22(4,5)6/h11-15H,1-10H3 |
| InChIKey | KTLYDZDWNMMADO-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.15 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|