C18H30BrNO3Si — CID 58946045
ethyl 3-[2-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-pyridinyl]propanoate (PubChem CID 58946045) has the molecular formula C18H30BrNO3Si and a molecular weight of 416.43 g/mol. Its IUPAC name is ethyl 3-[2-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-pyridinyl]propanoate.
| Compound Name | ethyl 3-[2-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 58946045 |
| Molecular Formula | C18H30BrNO3Si |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 3-[2-[2-bromo-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1cccnc1C(CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30BrNO3Si/c1-7-22-16(21)11-10-14-9-8-12-20-17(14)15(13-19)23-24(5,6)18(2,3)4/h8-9,12,15H,7,10-11,13H2,1-6H3 |
| InChIKey | JYEVIWNDUJNMJO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|