C20H29NO3Si — CID 11314376
ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-isoquinolin-7-ylpropanoate (PubChem CID 11314376) has the molecular formula C20H29NO3Si and a molecular weight of 359.54 g/mol. Its IUPAC name is ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-isoquinolin-7-ylpropanoate.
| Compound Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-isoquinolin-7-ylpropanoate |
|---|---|
| PubChem CID | 11314376 |
| Molecular Formula | C20H29NO3Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-isoquinolin-7-ylpropanoate |
| SMILES | CCOC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)c1ccc2ccncc2c1 |
| InChI | InChI=1S/C20H29NO3Si/c1-7-23-19(22)13-18(24-25(5,6)20(2,3)4)16-9-8-15-10-11-21-14-17(15)12-16/h8-12,14,18H,7,13H2,1-6H3/t18-/m0/s1 |
| InChIKey | DDJZGWUXBPGXFZ-SFHVURJKSA-N |
| XLogP | 5.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|