C17H28O3SSi — CID 134937106
ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfanylacetate (PubChem CID 134937106) has the molecular formula C17H28O3SSi and a molecular weight of 340.56 g/mol. Its IUPAC name is ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfanylacetate.
| Compound Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 134937106 |
| Molecular Formula | C17H28O3SSi |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-methylphenyl)sulfanylacetate |
| SMILES | CCOC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C17H28O3SSi/c1-8-19-15(18)16(20-22(6,7)17(3,4)5)21-14-11-9-13(2)10-12-14/h9-12,16H,8H2,1-7H3/t16-/m0/s1 |
| InChIKey | BGYLFHHGVCKYEA-INIZCTEOSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|