C20H28OSSi — CID 10617531
tert-butyl-[deuterio-(4-methylphenyl)sulfanyl-phenylmethoxy]-dimethylsilane (PubChem CID 10617531) has the molecular formula C20H28OSSi and a molecular weight of 345.60 g/mol. Its IUPAC name is tert-butyl-[deuterio-(4-methylphenyl)sulfanyl-phenylmethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[deuterio-(4-methylphenyl)sulfanyl-phenylmethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10617531 |
| Molecular Formula | C20H28OSSi |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl-[deuterio-(4-methylphenyl)sulfanyl-phenylmethoxy]-dimethylsilane |
| SMILES | [2H]C(O[Si](C)(C)C(C)(C)C)(Sc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H28OSSi/c1-16-12-14-18(15-13-16)22-19(17-10-8-7-9-11-17)21-23(5,6)20(2,3)4/h7-15,19H,1-6H3/i19D |
| InChIKey | KCXLKYBVTAMMIN-YUIGOLOMSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|