C23H32O2Si — CID 101242327
tert-butyl-[(E,1S)-4-methoxy-1,4-diphenylbut-2-enoxy]-dimethylsilane (PubChem CID 101242327) has the molecular formula C23H32O2Si and a molecular weight of 368.59 g/mol. Its IUPAC name is tert-butyl-[(E,1S)-4-methoxy-1,4-diphenylbut-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S)-4-methoxy-1,4-diphenylbut-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101242327 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | tert-butyl-[(E,1S)-4-methoxy-1,4-diphenylbut-2-enoxy]-dimethylsilane |
| SMILES | COC(/C=C/[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32O2Si/c1-23(2,3)26(5,6)25-22(20-15-11-8-12-16-20)18-17-21(24-4)19-13-9-7-10-14-19/h7-18,21-22H,1-6H3/b18-17+/t21?,22-/m0/s1 |
| InChIKey | NLVKBMXRKUNIHO-BUAZYOMISA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|