C13H16O — CID 164672506
[(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene (PubChem CID 164672506) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene.
| Compound Name | [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 164672506 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene |
| SMILES | C/C=C/C=C/C(OC)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-3-4-6-11-13(14-2)12-9-7-5-8-10-12/h3-11,13H,1-2H3/b4-3+,11-6+ |
| InChIKey | NTIHDYSYMVEUDI-HFBSYCRKSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|