About [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene
[(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene (PubChem CID 164672506) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene.
Molecular Properties
| Compound Name | [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene |
| PubChem CID | 164672506 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene |
| SMILES | C/C=C/C=C/C(OC)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-3-4-6-11-13(14-2)12-9-7-5-8-10-12/h3-11,13H,1-2H3/b4-3+,11-6+ |
| InChIKey | NTIHDYSYMVEUDI-HFBSYCRKSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene?
The IUPAC name of [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene (CID 164672506) is [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene.
What is the SMILES notation for [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene?
The canonical SMILES for [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene is C/C=C/C=C/C(OC)c1ccccc1.
What is the InChIKey of [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene?
The InChIKey is NTIHDYSYMVEUDI-HFBSYCRKSA-N. The full InChI is InChI=1S/C13H16O/c1-3-4-6-11-13(14-2)12-9-7-5-8-10-12/h3-11,13H,1-2H3/b4-3+,11-6+.
What are the key properties of [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene?
[(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene has a molecular weight of 188.27 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,4E)-1-methoxyhexa-2,4-dienyl]benzene is sourced from PubChem (CID 164672506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).