C25H26 — CID 140938349
[(5E,7E,9E,11E)-2-phenyltrideca-1,5,7,9,11-pentaen-4-yl]benzene (PubChem CID 140938349) has the molecular formula C25H26 and a molecular weight of 326.48 g/mol. Its IUPAC name is [(5E,7E,9E,11E)-2-phenyltrideca-1,5,7,9,11-pentaen-4-yl]benzene.
| Compound Name | [(5E,7E,9E,11E)-2-phenyltrideca-1,5,7,9,11-pentaen-4-yl]benzene |
|---|---|
| PubChem CID | 140938349 |
| Molecular Formula | C25H26 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | [(5E,7E,9E,11E)-2-phenyltrideca-1,5,7,9,11-pentaen-4-yl]benzene |
| SMILES | C=C(CC(/C=C/C=C/C=C/C=C/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26/c1-3-4-5-6-7-8-11-20-25(24-18-14-10-15-19-24)21-22(2)23-16-12-9-13-17-23/h3-20,25H,2,21H2,1H3/b4-3+,6-5+,8-7+,20-11+ |
| InChIKey | AMGKTTSGPKJRFU-AXBSCUGRSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|