C13H16F3N — CID 10728924
1,1,1-trifluoro-N,N-dimethyl-4-phenylpent-4-en-2-amine (PubChem CID 10728924) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-N,N-dimethyl-4-phenylpent-4-en-2-amine.
| Compound Name | 1,1,1-trifluoro-N,N-dimethyl-4-phenylpent-4-en-2-amine |
|---|---|
| PubChem CID | 10728924 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1,1,1-trifluoro-N,N-dimethyl-4-phenylpent-4-en-2-amine |
| SMILES | C=C(CC(N(C)C)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H16F3N/c1-10(11-7-5-4-6-8-11)9-12(17(2)3)13(14,15)16/h4-8,12H,1,9H2,2-3H3 |
| InChIKey | GGACCXJBIIMPRR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |