About N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane
N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane (PubChem CID 134906222) has the molecular formula C13H16BF6N
and a molecular weight of 311.08 g/mol. Its IUPAC name is N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane.
Molecular Properties
| Compound Name | N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane |
| PubChem CID | 134906222 |
| Molecular Formula | C13H16BF6N |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane |
| SMILES | C=C(CB(C(F)(F)F)C(F)(F)F)c1ccccc1.CNC |
| InChI | InChI=1S/C11H9BF6.C2H7N/c1-8(9-5-3-2-4-6-9)7-12(10(13,14)15)11(16,17)18;1-3-2/h2-6H,1,7H2;3H,1-2H3 |
| InChIKey | FMHCARSGSGGUTG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane?
The IUPAC name of N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane (CID 134906222) is N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane.
What is the SMILES notation for N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane?
The canonical SMILES for N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane is C=C(CB(C(F)(F)F)C(F)(F)F)c1ccccc1.CNC.
What is the InChIKey of N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane?
The InChIKey is FMHCARSGSGGUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BF6.C2H7N/c1-8(9-5-3-2-4-6-9)7-12(10(13,14)15)11(16,17)18;1-3-2/h2-6H,1,7H2;3H,1-2H3.
What are the key properties of N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane?
N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane has a molecular weight of 311.08 g/mol, XLogP of 4.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;2-phenylprop-2-enyl-bis(trifluoromethyl)borane is sourced from PubChem (CID 134906222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).