About 3-phenylbut-3-enoic acid
3-phenylbut-3-enoic acid (PubChem CID 10702134) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-phenylbut-3-enoic acid.
Molecular Properties
| Compound Name | 3-phenylbut-3-enoic acid |
| PubChem CID | 10702134 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 3-phenylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6H,1,7H2,(H,11,12) |
| InChIKey | YYGIPLBXWUIPEJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylbut-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbut-3-enoic acid?
The IUPAC name of 3-phenylbut-3-enoic acid (CID 10702134) is 3-phenylbut-3-enoic acid.
What is the SMILES notation for 3-phenylbut-3-enoic acid?
The canonical SMILES for 3-phenylbut-3-enoic acid is C=C(CC(=O)O)c1ccccc1.
What is the InChIKey of 3-phenylbut-3-enoic acid?
The InChIKey is YYGIPLBXWUIPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6H,1,7H2,(H,11,12).
What are the key properties of 3-phenylbut-3-enoic acid?
3-phenylbut-3-enoic acid has a molecular weight of 162.19 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbut-3-enoic acid is sourced from PubChem (CID 10702134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).