About 4-phenylpent-4-enoic acid;phosphenous acid
4-phenylpent-4-enoic acid;phosphenous acid (PubChem CID 175528610) has the molecular formula C11H13O4P
and a molecular weight of 240.19 g/mol. Its IUPAC name is 4-phenylpent-4-enoic acid;phosphenous acid.
Molecular Properties
| Compound Name | 4-phenylpent-4-enoic acid;phosphenous acid |
| PubChem CID | 175528610 |
| Molecular Formula | C11H13O4P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-phenylpent-4-enoic acid;phosphenous acid |
| SMILES | C=C(CCC(=O)O)c1ccccc1.O=PO |
| InChI | InChI=1S/C11H12O2.HO2P/c1-9(7-8-11(12)13)10-5-3-2-4-6-10;1-3-2/h2-6H,1,7-8H2,(H,12,13);(H,1,2) |
| InChIKey | OPVIUERPVWXUPP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylpent-4-enoic acid;phosphenous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpent-4-enoic acid;phosphenous acid?
The IUPAC name of 4-phenylpent-4-enoic acid;phosphenous acid (CID 175528610) is 4-phenylpent-4-enoic acid;phosphenous acid.
What is the SMILES notation for 4-phenylpent-4-enoic acid;phosphenous acid?
The canonical SMILES for 4-phenylpent-4-enoic acid;phosphenous acid is C=C(CCC(=O)O)c1ccccc1.O=PO.
What is the InChIKey of 4-phenylpent-4-enoic acid;phosphenous acid?
The InChIKey is OPVIUERPVWXUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.HO2P/c1-9(7-8-11(12)13)10-5-3-2-4-6-10;1-3-2/h2-6H,1,7-8H2,(H,12,13);(H,1,2).
What are the key properties of 4-phenylpent-4-enoic acid;phosphenous acid?
4-phenylpent-4-enoic acid;phosphenous acid has a molecular weight of 240.19 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpent-4-enoic acid;phosphenous acid is sourced from PubChem (CID 175528610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).