C15H17F3O — CID 14435912
1,1,1-trifluoro-8-phenylnon-8-en-2-one (PubChem CID 14435912) has the molecular formula C15H17F3O and a molecular weight of 270.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-8-phenylnon-8-en-2-one.
| Compound Name | 1,1,1-trifluoro-8-phenylnon-8-en-2-one |
|---|---|
| PubChem CID | 14435912 |
| Molecular Formula | C15H17F3O |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1,1,1-trifluoro-8-phenylnon-8-en-2-one |
| SMILES | C=C(CCCCCC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H17F3O/c1-12(13-9-5-3-6-10-13)8-4-2-7-11-14(19)15(16,17)18/h3,5-6,9-10H,1-2,4,7-8,11H2 |
| InChIKey | WVZPZCPNPCBIOY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|