C30H24F3N — CID 102223669
1,1-diphenyl-N-[1-phenyl-3-[4-(trifluoromethyl)phenyl]but-3-enyl]methanimine (PubChem CID 102223669) has the molecular formula C30H24F3N and a molecular weight of 455.52 g/mol. Its IUPAC name is 1,1-diphenyl-N-[1-phenyl-3-[4-(trifluoromethyl)phenyl]but-3-enyl]methanimine.
| Compound Name | 1,1-diphenyl-N-[1-phenyl-3-[4-(trifluoromethyl)phenyl]but-3-enyl]methanimine |
|---|---|
| PubChem CID | 102223669 |
| Molecular Formula | C30H24F3N |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1,1-diphenyl-N-[1-phenyl-3-[4-(trifluoromethyl)phenyl]but-3-enyl]methanimine |
| SMILES | C=C(CC(N=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H24F3N/c1-22(23-17-19-27(20-18-23)30(31,32)33)21-28(24-11-5-2-6-12-24)34-29(25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20,28H,1,21H2 |
| InChIKey | RTIGBGXDEPEJSE-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|