About 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate
2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate (PubChem CID 101401205) has the molecular formula C30H25NO2
and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate.
Molecular Properties
| Compound Name | 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate |
| PubChem CID | 101401205 |
| Molecular Formula | C30H25NO2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate |
| SMILES | C=C(COC(=O)C(N=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H25NO2/c1-23(24-14-6-2-7-15-24)22-33-30(32)29(27-20-12-5-13-21-27)31-28(25-16-8-3-9-17-25)26-18-10-4-11-19-26/h2-21,29H,1,22H2 |
| InChIKey | CHCSPHRWIHJRRF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
The IUPAC name of 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate (CID 101401205) is 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate.
What is the SMILES notation for 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
The canonical SMILES for 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate is C=C(COC(=O)C(N=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
The InChIKey is CHCSPHRWIHJRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H25NO2/c1-23(24-14-6-2-7-15-24)22-33-30(32)29(27-20-12-5-13-21-27)31-28(25-16-8-3-9-17-25)26-18-10-4-11-19-26/h2-21,29H,1,22H2.
What are the key properties of 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate has a molecular weight of 431.54 g/mol, XLogP of 6.52, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate is sourced from PubChem (CID 101401205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).