About 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate
2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate (PubChem CID 101401204) has the molecular formula C25H23NO2
and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate |
| PubChem CID | 101401204 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate |
| SMILES | C=C(C)COC(=O)C(N=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-19(2)18-28-25(27)24(22-16-10-5-11-17-22)26-23(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-17,24H,1,18H2,2H3 |
| InChIKey | YVCOGPKBFCFRRH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
The IUPAC name of 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate (CID 101401204) is 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate.
What is the SMILES notation for 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
The canonical SMILES for 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate is C=C(C)COC(=O)C(N=C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
The InChIKey is YVCOGPKBFCFRRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO2/c1-19(2)18-28-25(27)24(22-16-10-5-11-17-22)26-23(20-12-6-3-7-13-20)21-14-8-4-9-15-21/h3-17,24H,1,18H2,2H3.
What are the key properties of 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate?
2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate has a molecular weight of 369.46 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl 2-(benzhydrylideneamino)-2-phenylacetate is sourced from PubChem (CID 101401204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).