C24H19F4NO3 — CID 121361722
ethyl 2-(benzhydrylideneamino)-2-[3-fluoro-4-(trifluoromethoxy)phenyl]acetate (PubChem CID 121361722) has the molecular formula C24H19F4NO3 and a molecular weight of 445.41 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-2-[3-fluoro-4-(trifluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-2-[3-fluoro-4-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 121361722 |
| Molecular Formula | C24H19F4NO3 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-2-[3-fluoro-4-(trifluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)C(N=C(c1ccccc1)c1ccccc1)c1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C24H19F4NO3/c1-2-31-23(30)22(18-13-14-20(19(25)15-18)32-24(26,27)28)29-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15,22H,2H2,1H3 |
| InChIKey | HDISLTJBTUONOJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|