C19H32 — CID 144893157
ethane;methane;[(6Z)-octa-1,4,6-trien-2-yl]benzene (PubChem CID 144893157) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is ethane;methane;[(6Z)-octa-1,4,6-trien-2-yl]benzene.
| Compound Name | ethane;methane;[(6Z)-octa-1,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 144893157 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | ethane;methane;[(6Z)-octa-1,4,6-trien-2-yl]benzene |
| SMILES | C.C=C(CC=C/C=C\C)c1ccccc1.CC.CC |
| InChI | InChI=1S/C14H16.2C2H6.CH4/c1-3-4-5-7-10-13(2)14-11-8-6-9-12-14;2*1-2;/h3-9,11-12H,2,10H2,1H3;2*1-2H3;1H4/b4-3-,7-5?;;; |
| InChIKey | WXPUHNLIKQGEQX-YSJZLJDKSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|